C24H30N4O3 — CID 59074849
benzyl 4-[[[2-(cyclobutylamino)pyridine-4-carbonyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 59074849) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is benzyl 4-[[[2-(cyclobutylamino)pyridine-4-carbonyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[[[2-(cyclobutylamino)pyridine-4-carbonyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59074849 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | benzyl 4-[[[2-(cyclobutylamino)pyridine-4-carbonyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | O=C(NCC1CCN(C(=O)OCc2ccccc2)CC1)c1ccnc(NC2CCC2)c1 |
| InChI | InChI=1S/C24H30N4O3/c29-23(20-9-12-25-22(15-20)27-21-7-4-8-21)26-16-18-10-13-28(14-11-18)24(30)31-17-19-5-2-1-3-6-19/h1-3,5-6,9,12,15,18,21H,4,7-8,10-11,13-14,16-17H2,(H,25,27)(H,26,29) |
| InChIKey | BRJHMELBUBJYAG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |