C18H26ClNO2 — CID 153068459
6-(4-chlorophenyl)-1-[3-(hydroxymethyl)piperidin-1-yl]hexan-1-one (PubChem CID 153068459) has the molecular formula C18H26ClNO2 and a molecular weight of 323.86 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-1-[3-(hydroxymethyl)piperidin-1-yl]hexan-1-one.
| Compound Name | 6-(4-chlorophenyl)-1-[3-(hydroxymethyl)piperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 153068459 |
| Molecular Formula | C18H26ClNO2 |
| Molecular Weight | 323.86 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 6-(4-chlorophenyl)-1-[3-(hydroxymethyl)piperidin-1-yl]hexan-1-one |
| SMILES | O=C(CCCCCc1ccc(Cl)cc1)N1CCCC(CO)C1 |
| InChI | InChI=1S/C18H26ClNO2/c19-17-10-8-15(9-11-17)5-2-1-3-7-18(22)20-12-4-6-16(13-20)14-21/h8-11,16,21H,1-7,12-14H2 |
| InChIKey | VKWBBGDLRRKPLZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.86 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|