C22H34N2O2 — CID 26316227
1-[(3R)-3-[4-(hydroxymethyl)piperidin-1-yl]piperidin-1-yl]-5-phenylpentan-1-one (PubChem CID 26316227) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 1-[(3R)-3-[4-(hydroxymethyl)piperidin-1-yl]piperidin-1-yl]-5-phenylpentan-1-one.
| Compound Name | 1-[(3R)-3-[4-(hydroxymethyl)piperidin-1-yl]piperidin-1-yl]-5-phenylpentan-1-one |
|---|---|
| PubChem CID | 26316227 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 1-[(3R)-3-[4-(hydroxymethyl)piperidin-1-yl]piperidin-1-yl]-5-phenylpentan-1-one |
| SMILES | O=C(CCCCc1ccccc1)N1CCC[C@@H](N2CCC(CO)CC2)C1 |
| InChI | InChI=1S/C22H34N2O2/c25-18-20-12-15-23(16-13-20)21-10-6-14-24(17-21)22(26)11-5-4-9-19-7-2-1-3-8-19/h1-3,7-8,20-21,25H,4-6,9-18H2/t21-/m1/s1 |
| InChIKey | YOQHOVGFWQIQKM-OAQYLSRUSA-N |
| XLogP | 3.09 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|