C19H29NO2 — CID 110418717
1-[3-(ethoxymethyl)piperidin-1-yl]-4-(2-methylphenyl)butan-1-one (PubChem CID 110418717) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 1-[3-(ethoxymethyl)piperidin-1-yl]-4-(2-methylphenyl)butan-1-one.
| Compound Name | 1-[3-(ethoxymethyl)piperidin-1-yl]-4-(2-methylphenyl)butan-1-one |
|---|---|
| PubChem CID | 110418717 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 1-[3-(ethoxymethyl)piperidin-1-yl]-4-(2-methylphenyl)butan-1-one |
| SMILES | CCOCC1CCCN(C(=O)CCCc2ccccc2C)C1 |
| InChI | InChI=1S/C19H29NO2/c1-3-22-15-17-9-7-13-20(14-17)19(21)12-6-11-18-10-5-4-8-16(18)2/h4-5,8,10,17H,3,6-7,9,11-15H2,1-2H3 |
| InChIKey | GRBCSBJUOFZORT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |