C26H41N3O2 — CID 42378388
N-methyl-N-(1-methylpiperidin-4-yl)-3-[(3S)-1-(5-phenylpentanoyl)piperidin-3-yl]propanamide (PubChem CID 42378388) has the molecular formula C26H41N3O2 and a molecular weight of 427.63 g/mol. Its IUPAC name is N-methyl-N-(1-methylpiperidin-4-yl)-3-[(3S)-1-(5-phenylpentanoyl)piperidin-3-yl]propanamide.
| Compound Name | N-methyl-N-(1-methylpiperidin-4-yl)-3-[(3S)-1-(5-phenylpentanoyl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 42378388 |
| Molecular Formula | C26H41N3O2 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.32 |
| IUPAC Name | N-methyl-N-(1-methylpiperidin-4-yl)-3-[(3S)-1-(5-phenylpentanoyl)piperidin-3-yl]propanamide |
| SMILES | CN1CCC(N(C)C(=O)CC[C@@H]2CCCN(C(=O)CCCCc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C26H41N3O2/c1-27-19-16-24(17-20-27)28(2)25(30)15-14-23-12-8-18-29(21-23)26(31)13-7-6-11-22-9-4-3-5-10-22/h3-5,9-10,23-24H,6-8,11-21H2,1-2H3/t23-/m0/s1 |
| InChIKey | PJQKRKLJFCSZMG-QHCPKHFHSA-N |
| XLogP | 3.97 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|