C15H20N2O4S — CID 120721632
methyl 3-methyl-4-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)benzoate (PubChem CID 120721632) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is methyl 3-methyl-4-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)benzoate.
| Compound Name | methyl 3-methyl-4-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 120721632 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | methyl 3-methyl-4-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCC2=CCNCC2)c(C)c1 |
| InChI | InChI=1S/C15H20N2O4S/c1-11-9-13(15(18)21-2)3-4-14(11)22(19,20)17-10-12-5-7-16-8-6-12/h3-5,9,16-17H,6-8,10H2,1-2H3 |
| InChIKey | QXVFRHIKNMAOQK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|