C17H21NO5S — CID 9167758
(2S)-2-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)sulfonylethanamine (PubChem CID 9167758) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is (2S)-2-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)sulfonylethanamine.
| Compound Name | (2S)-2-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)sulfonylethanamine |
|---|---|
| PubChem CID | 9167758 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (2S)-2-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)sulfonylethanamine |
| SMILES | COc1ccc(S(=O)(=O)[C@H](CN)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C17H21NO5S/c1-21-13-5-7-14(8-6-13)24(19,20)17(11-18)12-4-9-15(22-2)16(10-12)23-3/h4-10,17H,11,18H2,1-3H3/t17-/m1/s1 |
| InChIKey | ZUUDQCVNLSXCKX-QGZVFWFLSA-N |
| XLogP | 2.19 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |