C16H16F3NO3S — CID 9168217
(2S)-2-(4-methoxyphenyl)sulfonyl-2-[4-(trifluoromethyl)phenyl]ethanamine (PubChem CID 9168217) has the molecular formula C16H16F3NO3S and a molecular weight of 359.37 g/mol. Its IUPAC name is (2S)-2-(4-methoxyphenyl)sulfonyl-2-[4-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | (2S)-2-(4-methoxyphenyl)sulfonyl-2-[4-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 9168217 |
| Molecular Formula | C16H16F3NO3S |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | (2S)-2-(4-methoxyphenyl)sulfonyl-2-[4-(trifluoromethyl)phenyl]ethanamine |
| SMILES | COc1ccc(S(=O)(=O)[C@H](CN)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H16F3NO3S/c1-23-13-6-8-14(9-7-13)24(21,22)15(10-20)11-2-4-12(5-3-11)16(17,18)19/h2-9,15H,10,20H2,1H3/t15-/m1/s1 |
| InChIKey | NDWLJDYSDAFVKS-OAHLLOKOSA-N |
| XLogP | 3.19 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |