C18H20F3NO2S — CID 118519663
5-phenyl-5-[4-(trifluoromethyl)phenyl]sulfonylpentan-1-amine (PubChem CID 118519663) has the molecular formula C18H20F3NO2S and a molecular weight of 371.42 g/mol. Its IUPAC name is 5-phenyl-5-[4-(trifluoromethyl)phenyl]sulfonylpentan-1-amine.
| Compound Name | 5-phenyl-5-[4-(trifluoromethyl)phenyl]sulfonylpentan-1-amine |
|---|---|
| PubChem CID | 118519663 |
| Molecular Formula | C18H20F3NO2S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 5-phenyl-5-[4-(trifluoromethyl)phenyl]sulfonylpentan-1-amine |
| SMILES | NCCCCC(c1ccccc1)S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H20F3NO2S/c19-18(20,21)15-9-11-16(12-10-15)25(23,24)17(8-4-5-13-22)14-6-2-1-3-7-14/h1-3,6-7,9-12,17H,4-5,8,13,22H2 |
| InChIKey | IQKUMZRJDMYFNU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|