C18H21ClO4S2 — CID 23028576
1-chloro-4-(5-methylsulfonyl-1-phenylpentyl)sulfonylbenzene (PubChem CID 23028576) has the molecular formula C18H21ClO4S2 and a molecular weight of 400.95 g/mol. Its IUPAC name is 1-chloro-4-(5-methylsulfonyl-1-phenylpentyl)sulfonylbenzene.
| Compound Name | 1-chloro-4-(5-methylsulfonyl-1-phenylpentyl)sulfonylbenzene |
|---|---|
| PubChem CID | 23028576 |
| Molecular Formula | C18H21ClO4S2 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 1-chloro-4-(5-methylsulfonyl-1-phenylpentyl)sulfonylbenzene |
| SMILES | CS(=O)(=O)CCCCC(c1ccccc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H21ClO4S2/c1-24(20,21)14-6-5-9-18(15-7-3-2-4-8-15)25(22,23)17-12-10-16(19)11-13-17/h2-4,7-8,10-13,18H,5-6,9,14H2,1H3 |
| InChIKey | HXJJJDSKPNDMOW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|