C23H21ClF2O2S — CID 23028629
2-[1-(4-chlorophenyl)sulfonyl-4-phenylpentyl]-1,4-difluorobenzene (PubChem CID 23028629) has the molecular formula C23H21ClF2O2S and a molecular weight of 434.94 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)sulfonyl-4-phenylpentyl]-1,4-difluorobenzene.
| Compound Name | 2-[1-(4-chlorophenyl)sulfonyl-4-phenylpentyl]-1,4-difluorobenzene |
|---|---|
| PubChem CID | 23028629 |
| Molecular Formula | C23H21ClF2O2S |
| Molecular Weight | 434.94 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 2-[1-(4-chlorophenyl)sulfonyl-4-phenylpentyl]-1,4-difluorobenzene |
| SMILES | CC(CCC(c1cc(F)ccc1F)S(=O)(=O)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H21ClF2O2S/c1-16(17-5-3-2-4-6-17)7-14-23(21-15-19(25)10-13-22(21)26)29(27,28)20-11-8-18(24)9-12-20/h2-6,8-13,15-16,23H,7,14H2,1H3 |
| InChIKey | ZLUMRUOZTDNQJA-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.94 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |