C17H15ClF2O3S — CID 86601720
4-(4-chlorophenyl)sulfonyl-4-(2,5-difluorophenyl)-3-methylbutanal (PubChem CID 86601720) has the molecular formula C17H15ClF2O3S and a molecular weight of 372.82 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfonyl-4-(2,5-difluorophenyl)-3-methylbutanal.
| Compound Name | 4-(4-chlorophenyl)sulfonyl-4-(2,5-difluorophenyl)-3-methylbutanal |
|---|---|
| PubChem CID | 86601720 |
| Molecular Formula | C17H15ClF2O3S |
| Molecular Weight | 372.82 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 4-(4-chlorophenyl)sulfonyl-4-(2,5-difluorophenyl)-3-methylbutanal |
| SMILES | CC(CC=O)C(c1cc(F)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClF2O3S/c1-11(8-9-21)17(15-10-13(19)4-7-16(15)20)24(22,23)14-5-2-12(18)3-6-14/h2-7,9-11,17H,8H2,1H3 |
| InChIKey | NDKHDCXNVLSPQK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.82 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|