C16H13ClF2O4S — CID 142175698
ethyl 2-(4-chlorophenyl)sulfonyl-2-(2,5-difluorophenyl)acetate (PubChem CID 142175698) has the molecular formula C16H13ClF2O4S and a molecular weight of 374.79 g/mol. Its IUPAC name is ethyl 2-(4-chlorophenyl)sulfonyl-2-(2,5-difluorophenyl)acetate.
| Compound Name | ethyl 2-(4-chlorophenyl)sulfonyl-2-(2,5-difluorophenyl)acetate |
|---|---|
| PubChem CID | 142175698 |
| Molecular Formula | C16H13ClF2O4S |
| Molecular Weight | 374.79 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | ethyl 2-(4-chlorophenyl)sulfonyl-2-(2,5-difluorophenyl)acetate |
| SMILES | CCOC(=O)C(c1cc(F)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClF2O4S/c1-2-23-16(20)15(13-9-11(18)5-8-14(13)19)24(21,22)12-6-3-10(17)4-7-12/h3-9,15H,2H2,1H3 |
| InChIKey | HQLORGJFOUGKSD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.79 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |