C23H28ClF2NO4S2 — CID 89262916
tert-butyl N-[5-(4-chlorophenyl)sulfonyl-5-(2,5-difluorophenyl)pentyl]-N-methylsulfanylcarbamate (PubChem CID 89262916) has the molecular formula C23H28ClF2NO4S2 and a molecular weight of 520.06 g/mol. Its IUPAC name is tert-butyl N-[5-(4-chlorophenyl)sulfonyl-5-(2,5-difluorophenyl)pentyl]-N-methylsulfanylcarbamate.
| Compound Name | tert-butyl N-[5-(4-chlorophenyl)sulfonyl-5-(2,5-difluorophenyl)pentyl]-N-methylsulfanylcarbamate |
|---|---|
| PubChem CID | 89262916 |
| Molecular Formula | C23H28ClF2NO4S2 |
| Molecular Weight | 520.06 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | tert-butyl N-[5-(4-chlorophenyl)sulfonyl-5-(2,5-difluorophenyl)pentyl]-N-methylsulfanylcarbamate |
| SMILES | CSN(CCCCC(c1cc(F)ccc1F)S(=O)(=O)c1ccc(Cl)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H28ClF2NO4S2/c1-23(2,3)31-22(28)27(32-4)14-6-5-7-21(19-15-17(25)10-13-20(19)26)33(29,30)18-11-8-16(24)9-12-18/h8-13,15,21H,5-7,14H2,1-4H3 |
| InChIKey | VMFFRYNWMQPZDO-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.06 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|