C19H16ClF2NO2S — CID 59750748
1-[3-(4-chlorophenyl)sulfonyl-3-(2,5-difluorophenyl)propyl]pyrrole (PubChem CID 59750748) has the molecular formula C19H16ClF2NO2S and a molecular weight of 395.86 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)sulfonyl-3-(2,5-difluorophenyl)propyl]pyrrole.
| Compound Name | 1-[3-(4-chlorophenyl)sulfonyl-3-(2,5-difluorophenyl)propyl]pyrrole |
|---|---|
| PubChem CID | 59750748 |
| Molecular Formula | C19H16ClF2NO2S |
| Molecular Weight | 395.86 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 1-[3-(4-chlorophenyl)sulfonyl-3-(2,5-difluorophenyl)propyl]pyrrole |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)C(CCn1cccc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C19H16ClF2NO2S/c20-14-3-6-16(7-4-14)26(24,25)19(9-12-23-10-1-2-11-23)17-13-15(21)5-8-18(17)22/h1-8,10-11,13,19H,9,12H2 |
| InChIKey | OXKBVVDHUIFYRA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.86 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |