C19H21ClF2O4S2 — CID 59750834
2-[1-(4-chlorophenyl)sulfonyl-6-methylsulfonylhexyl]-1,4-difluorobenzene (PubChem CID 59750834) has the molecular formula C19H21ClF2O4S2 and a molecular weight of 450.96 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)sulfonyl-6-methylsulfonylhexyl]-1,4-difluorobenzene.
| Compound Name | 2-[1-(4-chlorophenyl)sulfonyl-6-methylsulfonylhexyl]-1,4-difluorobenzene |
|---|---|
| PubChem CID | 59750834 |
| Molecular Formula | C19H21ClF2O4S2 |
| Molecular Weight | 450.96 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | 2-[1-(4-chlorophenyl)sulfonyl-6-methylsulfonylhexyl]-1,4-difluorobenzene |
| SMILES | CS(=O)(=O)CCCCCC(c1cc(F)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClF2O4S2/c1-27(23,24)12-4-2-3-5-19(17-13-15(21)8-11-18(17)22)28(25,26)16-9-6-14(20)7-10-16/h6-11,13,19H,2-5,12H2,1H3 |
| InChIKey | PIYULFPRPHVECV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.96 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|