C17H19Cl2NO4S2 — CID 59750907
2-chloro-3-[1-(4-chlorophenyl)sulfonyl-5-methylsulfonylpentyl]pyridine (PubChem CID 59750907) has the molecular formula C17H19Cl2NO4S2 and a molecular weight of 436.38 g/mol. Its IUPAC name is 2-chloro-3-[1-(4-chlorophenyl)sulfonyl-5-methylsulfonylpentyl]pyridine.
| Compound Name | 2-chloro-3-[1-(4-chlorophenyl)sulfonyl-5-methylsulfonylpentyl]pyridine |
|---|---|
| PubChem CID | 59750907 |
| Molecular Formula | C17H19Cl2NO4S2 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | 2-chloro-3-[1-(4-chlorophenyl)sulfonyl-5-methylsulfonylpentyl]pyridine |
| SMILES | CS(=O)(=O)CCCCC(c1cccnc1Cl)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19Cl2NO4S2/c1-25(21,22)12-3-2-6-16(15-5-4-11-20-17(15)19)26(23,24)14-9-7-13(18)8-10-14/h4-5,7-11,16H,2-3,6,12H2,1H3 |
| InChIKey | AGZYDXLFDDTPKE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 81.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|