C33H35ClF2O3S3 — CID 59750802
tert-butyl-[2-[3-(4-chlorophenyl)sulfonyl-3-(2,5-difluorophenyl)propyl]sulfanylethoxy]-diphenyl-λ4-sulfane (PubChem CID 59750802) has the molecular formula C33H35ClF2O3S3 and a molecular weight of 649.29 g/mol. Its IUPAC name is tert-butyl-[2-[3-(4-chlorophenyl)sulfonyl-3-(2,5-difluorophenyl)propyl]sulfanylethoxy]-diphenyl-λ4-sulfane.
| Compound Name | tert-butyl-[2-[3-(4-chlorophenyl)sulfonyl-3-(2,5-difluorophenyl)propyl]sulfanylethoxy]-diphenyl-λ4-sulfane |
|---|---|
| PubChem CID | 59750802 |
| Molecular Formula | C33H35ClF2O3S3 |
| Molecular Weight | 649.29 g/mol |
| Exact Mass | 648.14 |
| IUPAC Name | tert-butyl-[2-[3-(4-chlorophenyl)sulfonyl-3-(2,5-difluorophenyl)propyl]sulfanylethoxy]-diphenyl-λ4-sulfane |
| SMILES | CC(C)(C)S(OCCSCCC(c1cc(F)ccc1F)S(=O)(=O)c1ccc(Cl)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H35ClF2O3S3/c1-33(2,3)41(27-10-6-4-7-11-27,28-12-8-5-9-13-28)39-21-23-40-22-20-32(30-24-26(35)16-19-31(30)36)42(37,38)29-17-14-25(34)15-18-29/h4-19,24,32H,20-23H2,1-3H3 |
| InChIKey | UDIGIGQMJDMTQD-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.29 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|