C21H25F2NO4S — CID 154539353
propyl N-[4-(2,5-difluorophenyl)-4-(4-methylphenyl)sulfonylbutyl]carbamate (PubChem CID 154539353) has the molecular formula C21H25F2NO4S and a molecular weight of 425.50 g/mol. Its IUPAC name is propyl N-[4-(2,5-difluorophenyl)-4-(4-methylphenyl)sulfonylbutyl]carbamate.
| Compound Name | propyl N-[4-(2,5-difluorophenyl)-4-(4-methylphenyl)sulfonylbutyl]carbamate |
|---|---|
| PubChem CID | 154539353 |
| Molecular Formula | C21H25F2NO4S |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | propyl N-[4-(2,5-difluorophenyl)-4-(4-methylphenyl)sulfonylbutyl]carbamate |
| SMILES | CCCOC(=O)NCCCC(c1cc(F)ccc1F)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H25F2NO4S/c1-3-13-28-21(25)24-12-4-5-20(18-14-16(22)8-11-19(18)23)29(26,27)17-9-6-15(2)7-10-17/h6-11,14,20H,3-5,12-13H2,1-2H3,(H,24,25) |
| InChIKey | UBNWTAPHRCTUMO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|