C17H18F3NO2S — CID 57101391
3-[3-[4-(trifluoromethyl)phenyl]sulfonylphenyl]butan-1-amine (PubChem CID 57101391) has the molecular formula C17H18F3NO2S and a molecular weight of 357.40 g/mol. Its IUPAC name is 3-[3-[4-(trifluoromethyl)phenyl]sulfonylphenyl]butan-1-amine.
| Compound Name | 3-[3-[4-(trifluoromethyl)phenyl]sulfonylphenyl]butan-1-amine |
|---|---|
| PubChem CID | 57101391 |
| Molecular Formula | C17H18F3NO2S |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 3-[3-[4-(trifluoromethyl)phenyl]sulfonylphenyl]butan-1-amine |
| SMILES | CC(CCN)c1cccc(S(=O)(=O)c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C17H18F3NO2S/c1-12(9-10-21)13-3-2-4-16(11-13)24(22,23)15-7-5-14(6-8-15)17(18,19)20/h2-8,11-12H,9-10,21H2,1H3 |
| InChIKey | IHPMQHYRDAQZIJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |