C17H22NO5S+ — CID 9167955
[(2S)-2-(2,4-dimethoxyphenyl)-2-(4-methoxyphenyl)sulfonylethyl]azanium (PubChem CID 9167955) has the molecular formula C17H22NO5S+ and a molecular weight of 352.43 g/mol. Its IUPAC name is [(2S)-2-(2,4-dimethoxyphenyl)-2-(4-methoxyphenyl)sulfonylethyl]azanium.
| Compound Name | [(2S)-2-(2,4-dimethoxyphenyl)-2-(4-methoxyphenyl)sulfonylethyl]azanium |
|---|---|
| PubChem CID | 9167955 |
| Molecular Formula | C17H22NO5S+ |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [(2S)-2-(2,4-dimethoxyphenyl)-2-(4-methoxyphenyl)sulfonylethyl]azanium |
| SMILES | COc1ccc(S(=O)(=O)[C@H](C[NH3+])c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C17H21NO5S/c1-21-12-4-7-14(8-5-12)24(19,20)17(11-18)15-9-6-13(22-2)10-16(15)23-3/h4-10,17H,11,18H2,1-3H3/p+1/t17-/m1/s1 |
| InChIKey | DZGUCVJIXFWNJO-QGZVFWFLSA-O |
| XLogP | 1.47 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |