C19H27N2O3S+ — CID 9168537
[(2S)-2-[4-(diethylamino)phenyl]-2-(4-methoxyphenyl)sulfonylethyl]azanium (PubChem CID 9168537) has the molecular formula C19H27N2O3S+ and a molecular weight of 363.50 g/mol. Its IUPAC name is [(2S)-2-[4-(diethylamino)phenyl]-2-(4-methoxyphenyl)sulfonylethyl]azanium.
| Compound Name | [(2S)-2-[4-(diethylamino)phenyl]-2-(4-methoxyphenyl)sulfonylethyl]azanium |
|---|---|
| PubChem CID | 9168537 |
| Molecular Formula | C19H27N2O3S+ |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | [(2S)-2-[4-(diethylamino)phenyl]-2-(4-methoxyphenyl)sulfonylethyl]azanium |
| SMILES | CCN(CC)c1ccc([C@@H](C[NH3+])S(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H26N2O3S/c1-4-21(5-2)16-8-6-15(7-9-16)19(14-20)25(22,23)18-12-10-17(24-3)11-13-18/h6-13,19H,4-5,14,20H2,1-3H3/p+1/t19-/m1/s1 |
| InChIKey | KACLDZMDIQZOCG-LJQANCHMSA-O |
| XLogP | 2.30 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|