C20H25N3O5S — CID 9160093
N'-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methoxyphenyl)sulfonylethyl]-N-methyloxamide (PubChem CID 9160093) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is N'-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methoxyphenyl)sulfonylethyl]-N-methyloxamide.
| Compound Name | N'-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methoxyphenyl)sulfonylethyl]-N-methyloxamide |
|---|---|
| PubChem CID | 9160093 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N'-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methoxyphenyl)sulfonylethyl]-N-methyloxamide |
| SMILES | CNC(=O)C(=O)NC[C@H](c1ccc(N(C)C)cc1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H25N3O5S/c1-21-19(24)20(25)22-13-18(14-5-7-15(8-6-14)23(2)3)29(26,27)17-11-9-16(28-4)10-12-17/h5-12,18H,13H2,1-4H3,(H,21,24)(H,22,25)/t18-/m1/s1 |
| InChIKey | OKYXDBOSEKPRMH-GOSISDBHSA-N |
| XLogP | 1.14 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|