C20H25NO4S — CID 110315082
N-[2-(4-methoxyphenyl)sulfonyl-2-phenylethyl]-3-methylbutanamide (PubChem CID 110315082) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)sulfonyl-2-phenylethyl]-3-methylbutanamide.
| Compound Name | N-[2-(4-methoxyphenyl)sulfonyl-2-phenylethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 110315082 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-[2-(4-methoxyphenyl)sulfonyl-2-phenylethyl]-3-methylbutanamide |
| SMILES | COc1ccc(S(=O)(=O)C(CNC(=O)CC(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H25NO4S/c1-15(2)13-20(22)21-14-19(16-7-5-4-6-8-16)26(23,24)18-11-9-17(25-3)10-12-18/h4-12,15,19H,13-14H2,1-3H3,(H,21,22) |
| InChIKey | OPKFKZOPOHBCQG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |