C18H21NO3S — CID 9184545
N-[(2R)-2-(benzenesulfonyl)-2-phenylethyl]-2-methylpropanamide (PubChem CID 9184545) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is N-[(2R)-2-(benzenesulfonyl)-2-phenylethyl]-2-methylpropanamide.
| Compound Name | N-[(2R)-2-(benzenesulfonyl)-2-phenylethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 9184545 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-[(2R)-2-(benzenesulfonyl)-2-phenylethyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC[C@@H](c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H21NO3S/c1-14(2)18(20)19-13-17(15-9-5-3-6-10-15)23(21,22)16-11-7-4-8-12-16/h3-12,14,17H,13H2,1-2H3,(H,19,20)/t17-/m0/s1 |
| InChIKey | DOIPSPWWYGFARW-KRWDZBQOSA-N |
| XLogP | 2.97 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |