C23H23NO3S — CID 9184966
N-[(2R)-2-(benzenesulfonyl)-2-phenylethyl]-3-phenylpropanamide (PubChem CID 9184966) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[(2R)-2-(benzenesulfonyl)-2-phenylethyl]-3-phenylpropanamide.
| Compound Name | N-[(2R)-2-(benzenesulfonyl)-2-phenylethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 9184966 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-[(2R)-2-(benzenesulfonyl)-2-phenylethyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)NC[C@@H](c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H23NO3S/c25-23(17-16-19-10-4-1-5-11-19)24-18-22(20-12-6-2-7-13-20)28(26,27)21-14-8-3-9-15-21/h1-15,22H,16-18H2,(H,24,25)/t22-/m0/s1 |
| InChIKey | OUYBAZKUWJUPHO-QFIPXVFZSA-N |
| XLogP | 3.95 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |