C16H20NO3S+ — CID 9161856
[(2R)-2-(4-methoxyphenyl)sulfonyl-2-(3-methylphenyl)ethyl]azanium (PubChem CID 9161856) has the molecular formula C16H20NO3S+ and a molecular weight of 306.41 g/mol. Its IUPAC name is [(2R)-2-(4-methoxyphenyl)sulfonyl-2-(3-methylphenyl)ethyl]azanium.
| Compound Name | [(2R)-2-(4-methoxyphenyl)sulfonyl-2-(3-methylphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 9161856 |
| Molecular Formula | C16H20NO3S+ |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | [(2R)-2-(4-methoxyphenyl)sulfonyl-2-(3-methylphenyl)ethyl]azanium |
| SMILES | COc1ccc(S(=O)(=O)[C@@H](C[NH3+])c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C16H19NO3S/c1-12-4-3-5-13(10-12)16(11-17)21(18,19)15-8-6-14(20-2)7-9-15/h3-10,16H,11,17H2,1-2H3/p+1/t16-/m0/s1 |
| InChIKey | DCTOUNABCNAELR-INIZCTEOSA-O |
| XLogP | 1.76 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |