C11H16N2O5PS+ — CID 58914660
ethylperoxy-[(2E)-2-[(4-methylphenyl)sulfonylhydrazinylidene]ethyl]-oxophosphanium (PubChem CID 58914660) has the molecular formula C11H16N2O5PS+ and a molecular weight of 319.30 g/mol. Its IUPAC name is ethylperoxy-[(2E)-2-[(4-methylphenyl)sulfonylhydrazinylidene]ethyl]-oxophosphanium.
| Compound Name | ethylperoxy-[(2E)-2-[(4-methylphenyl)sulfonylhydrazinylidene]ethyl]-oxophosphanium |
|---|---|
| PubChem CID | 58914660 |
| Molecular Formula | C11H16N2O5PS+ |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | ethylperoxy-[(2E)-2-[(4-methylphenyl)sulfonylhydrazinylidene]ethyl]-oxophosphanium |
| SMILES | CCOO[P+](=O)C/C=N/NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C11H16N2O5PS/c1-3-17-18-19(14)9-8-12-13-20(15,16)11-6-4-10(2)5-7-11/h4-8,13H,3,9H2,1-2H3/q+1/b12-8+ |
| InChIKey | MGUPARMELKUGCE-XYOKQWHBSA-N |
| XLogP | 1.97 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|