C14H22N2O2SSi — CID 10781288
4-methyl-N-[(E)-(1-trimethylsilylcyclopropyl)methylideneamino]benzenesulfonamide (PubChem CID 10781288) has the molecular formula C14H22N2O2SSi and a molecular weight of 310.50 g/mol. Its IUPAC name is 4-methyl-N-[(E)-(1-trimethylsilylcyclopropyl)methylideneamino]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(E)-(1-trimethylsilylcyclopropyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 10781288 |
| Molecular Formula | C14H22N2O2SSi |
| Molecular Weight | 310.50 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 4-methyl-N-[(E)-(1-trimethylsilylcyclopropyl)methylideneamino]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C/C2([Si](C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C14H22N2O2SSi/c1-12-5-7-13(8-6-12)19(17,18)16-15-11-14(9-10-14)20(2,3)4/h5-8,11,16H,9-10H2,1-4H3/b15-11+ |
| InChIKey | XNOIKPGGODULIF-RVDMUPIBSA-N |
| XLogP | 3.13 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|