C20H25NO5S2 — CID 146018306
[(E)-5-[(4-methylphenyl)sulfonylamino]hex-3-enyl] 4-methylbenzenesulfonate (PubChem CID 146018306) has the molecular formula C20H25NO5S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is [(E)-5-[(4-methylphenyl)sulfonylamino]hex-3-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(E)-5-[(4-methylphenyl)sulfonylamino]hex-3-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 146018306 |
| Molecular Formula | C20H25NO5S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | [(E)-5-[(4-methylphenyl)sulfonylamino]hex-3-enyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)/C=C/CCOS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H25NO5S2/c1-16-7-11-19(12-8-16)27(22,23)21-18(3)6-4-5-15-26-28(24,25)20-13-9-17(2)10-14-20/h4,6-14,18,21H,5,15H2,1-3H3/b6-4+ |
| InChIKey | RLEZVNNJDROUBV-GQCTYLIASA-N |
| XLogP | 3.32 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|