C20H35NO2SSi — CID 164684876
N-[(E,1R)-1-[tert-butyl(dimethyl)silyl]-4,4-dimethylpent-2-enyl]-4-methylbenzenesulfonamide (PubChem CID 164684876) has the molecular formula C20H35NO2SSi and a molecular weight of 381.66 g/mol. Its IUPAC name is N-[(E,1R)-1-[tert-butyl(dimethyl)silyl]-4,4-dimethylpent-2-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E,1R)-1-[tert-butyl(dimethyl)silyl]-4,4-dimethylpent-2-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 164684876 |
| Molecular Formula | C20H35NO2SSi |
| Molecular Weight | 381.66 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-[(E,1R)-1-[tert-butyl(dimethyl)silyl]-4,4-dimethylpent-2-enyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](/C=C/C(C)(C)C)[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H35NO2SSi/c1-16-10-12-17(13-11-16)24(22,23)21-18(14-15-19(2,3)4)25(8,9)20(5,6)7/h10-15,18,21H,1-9H3/b15-14+/t18-/m1/s1 |
| InChIKey | FFPHZCCSRRZTDR-LGHUBQEGSA-N |
| XLogP | 5.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.66 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|