C11H13F3O3S — CID 175824893
(1,1,2,2,3,3-hexadeuterio-4,4,4-trifluorobutyl) 4-methylbenzenesulfonate (PubChem CID 175824893) has the molecular formula C11H13F3O3S and a molecular weight of 288.32 g/mol. Its IUPAC name is (1,1,2,2,3,3-hexadeuterio-4,4,4-trifluorobutyl) 4-methylbenzenesulfonate.
| Compound Name | (1,1,2,2,3,3-hexadeuterio-4,4,4-trifluorobutyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 175824893 |
| Molecular Formula | C11H13F3O3S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | (1,1,2,2,3,3-hexadeuterio-4,4,4-trifluorobutyl) 4-methylbenzenesulfonate |
| SMILES | [2H]C([2H])(OS(=O)(=O)c1ccc(C)cc1)C([2H])([2H])C([2H])([2H])C(F)(F)F |
| InChI | InChI=1S/C11H13F3O3S/c1-9-3-5-10(6-4-9)18(15,16)17-8-2-7-11(12,13)14/h3-6H,2,7-8H2,1H3/i2D2,7D2,8D2 |
| InChIKey | GCDCOBYBHQJKDU-RKXSNLOHSA-N |
| XLogP | 3.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|