C26H34N4O8S — CID 175266035
2-[[(2S)-2-azido-3-methylbutanoyl]amino]-4-[4-[2-(hydroxymethyl)-3-(4-methylphenyl)sulfonyloxypropoxy]phenyl]butanoic acid (PubChem CID 175266035) has the molecular formula C26H34N4O8S and a molecular weight of 562.65 g/mol. Its IUPAC name is 2-[[(2S)-2-azido-3-methylbutanoyl]amino]-4-[4-[2-(hydroxymethyl)-3-(4-methylphenyl)sulfonyloxypropoxy]phenyl]butanoic acid.
| Compound Name | 2-[[(2S)-2-azido-3-methylbutanoyl]amino]-4-[4-[2-(hydroxymethyl)-3-(4-methylphenyl)sulfonyloxypropoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 175266035 |
| Molecular Formula | C26H34N4O8S |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 2-[[(2S)-2-azido-3-methylbutanoyl]amino]-4-[4-[2-(hydroxymethyl)-3-(4-methylphenyl)sulfonyloxypropoxy]phenyl]butanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)OCC(CO)COc2ccc(CCC(NC(=O)[C@@H](N=[N+]=[N-])C(C)C)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C26H34N4O8S/c1-17(2)24(29-30-27)25(32)28-23(26(33)34)13-8-19-6-9-21(10-7-19)37-15-20(14-31)16-38-39(35,36)22-11-4-18(3)5-12-22/h4-7,9-12,17,20,23-24,31H,8,13-16H2,1-3H3,(H,28,32)(H,33,34)/t20?,23?,24-/m0/s1 |
| InChIKey | IZIXHBLLFRRZDX-BOYUCYPVSA-N |
| XLogP | 3.22 |
| TPSA | 187.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|