C33H35F3N4O9S — CID 174592962
ethyl 2-[[(2S)-3-[4-[2-acetyloxy-3-(4-methylphenyl)sulfonyloxypropoxy]phenyl]-2-azidopropanoyl]amino]-3-[4-(trifluoromethyl)phenyl]propanoate (PubChem CID 174592962) has the molecular formula C33H35F3N4O9S and a molecular weight of 720.72 g/mol. Its IUPAC name is ethyl 2-[[(2S)-3-[4-[2-acetyloxy-3-(4-methylphenyl)sulfonyloxypropoxy]phenyl]-2-azidopropanoyl]amino]-3-[4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl 2-[[(2S)-3-[4-[2-acetyloxy-3-(4-methylphenyl)sulfonyloxypropoxy]phenyl]-2-azidopropanoyl]amino]-3-[4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 174592962 |
| Molecular Formula | C33H35F3N4O9S |
| Molecular Weight | 720.72 g/mol |
| Exact Mass | 720.21 |
| IUPAC Name | ethyl 2-[[(2S)-3-[4-[2-acetyloxy-3-(4-methylphenyl)sulfonyloxypropoxy]phenyl]-2-azidopropanoyl]amino]-3-[4-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(C(F)(F)F)cc1)NC(=O)[C@H](Cc1ccc(OCC(COS(=O)(=O)c2ccc(C)cc2)OC(C)=O)cc1)N=[N+]=[N-] |
| InChI | InChI=1S/C33H35F3N4O9S/c1-4-46-32(43)30(18-23-7-11-25(12-8-23)33(34,35)36)38-31(42)29(39-40-37)17-24-9-13-26(14-10-24)47-19-27(49-22(3)41)20-48-50(44,45)28-15-5-21(2)6-16-28/h5-16,27,29-30H,4,17-20H2,1-3H3,(H,38,42)/t27?,29-,30?/m0/s1 |
| InChIKey | IMKAHHHBFDFPLW-DFQUZENCSA-N |
| XLogP | 5.24 |
| TPSA | 183.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.72 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|