C23H27F3N2O9S3 — CID 162156858
4-ethoxybenzenesulfonamide;4-hydroxybenzenesulfonamide;2,2,2-trifluoroethyl 4-methylbenzenesulfonate (PubChem CID 162156858) has the molecular formula C23H27F3N2O9S3 and a molecular weight of 628.67 g/mol. Its IUPAC name is 4-ethoxybenzenesulfonamide;4-hydroxybenzenesulfonamide;2,2,2-trifluoroethyl 4-methylbenzenesulfonate.
| Compound Name | 4-ethoxybenzenesulfonamide;4-hydroxybenzenesulfonamide;2,2,2-trifluoroethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 162156858 |
| Molecular Formula | C23H27F3N2O9S3 |
| Molecular Weight | 628.67 g/mol |
| Exact Mass | 628.08 |
| IUPAC Name | 4-ethoxybenzenesulfonamide;4-hydroxybenzenesulfonamide;2,2,2-trifluoroethyl 4-methylbenzenesulfonate |
| SMILES | CCOc1ccc(S(N)(=O)=O)cc1.Cc1ccc(S(=O)(=O)OCC(F)(F)F)cc1.NS(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H9F3O3S.C8H11NO3S.C6H7NO3S/c1-7-2-4-8(5-3-7)16(13,14)15-6-9(10,11)12;1-2-12-7-3-5-8(6-4-7)13(9,10)11;7-11(9,10)6-3-1-5(8)2-4-6/h2-5H,6H2,1H3;3-6H,2H2,1H3,(H2,9,10,11);1-4,8H,(H2,7,9,10) |
| InChIKey | ZLYCOJUGHMSGFL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 193.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.67 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|