C24H28N4O9S — CID 57482746
methyl 3-[4-[2-acetyloxy-3-(4-methylphenyl)sulfonyloxypropoxy]phenyl]-2-[(2-azidoacetyl)amino]propanoate (PubChem CID 57482746) has the molecular formula C24H28N4O9S and a molecular weight of 548.57 g/mol. Its IUPAC name is methyl 3-[4-[2-acetyloxy-3-(4-methylphenyl)sulfonyloxypropoxy]phenyl]-2-[(2-azidoacetyl)amino]propanoate.
| Compound Name | methyl 3-[4-[2-acetyloxy-3-(4-methylphenyl)sulfonyloxypropoxy]phenyl]-2-[(2-azidoacetyl)amino]propanoate |
|---|---|
| PubChem CID | 57482746 |
| Molecular Formula | C24H28N4O9S |
| Molecular Weight | 548.57 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | methyl 3-[4-[2-acetyloxy-3-(4-methylphenyl)sulfonyloxypropoxy]phenyl]-2-[(2-azidoacetyl)amino]propanoate |
| SMILES | COC(=O)C(Cc1ccc(OCC(COS(=O)(=O)c2ccc(C)cc2)OC(C)=O)cc1)NC(=O)CN=[N+]=[N-] |
| InChI | InChI=1S/C24H28N4O9S/c1-16-4-10-21(11-5-16)38(32,33)36-15-20(37-17(2)29)14-35-19-8-6-18(7-9-19)12-22(24(31)34-3)27-23(30)13-26-28-25/h4-11,20,22H,12-15H2,1-3H3,(H,27,30) |
| InChIKey | WZFSYLOSNUXBOP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 183.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.57 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|