C14H17FN4O4 — CID 59552700
methyl (2S)-2-[(2-azidoacetyl)amino]-3-[4-(2-fluoroethoxy)phenyl]propanoate (PubChem CID 59552700) has the molecular formula C14H17FN4O4 and a molecular weight of 324.31 g/mol. Its IUPAC name is methyl (2S)-2-[(2-azidoacetyl)amino]-3-[4-(2-fluoroethoxy)phenyl]propanoate.
| Compound Name | methyl (2S)-2-[(2-azidoacetyl)amino]-3-[4-(2-fluoroethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 59552700 |
| Molecular Formula | C14H17FN4O4 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | methyl (2S)-2-[(2-azidoacetyl)amino]-3-[4-(2-fluoroethoxy)phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCCF)cc1)NC(=O)CN=[N+]=[N-] |
| InChI | InChI=1S/C14H17FN4O4/c1-22-14(21)12(18-13(20)9-17-19-16)8-10-2-4-11(5-3-10)23-7-6-15/h2-5,12H,6-9H2,1H3,(H,18,20)/t12-/m0/s1 |
| InChIKey | TYFSZMJMGHXPRG-LBPRGKRZSA-N |
| XLogP | 1.55 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|