C14H17N5O4 — CID 71480771
(2S)-2-[3-[(2-azidoacetyl)amino]propanoylamino]-3-phenylpropanoic acid (PubChem CID 71480771) has the molecular formula C14H17N5O4 and a molecular weight of 319.32 g/mol. Its IUPAC name is (2S)-2-[3-[(2-azidoacetyl)amino]propanoylamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[3-[(2-azidoacetyl)amino]propanoylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 71480771 |
| Molecular Formula | C14H17N5O4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | (2S)-2-[3-[(2-azidoacetyl)amino]propanoylamino]-3-phenylpropanoic acid |
| SMILES | [N-]=[N+]=NCC(=O)NCCC(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H17N5O4/c15-19-17-9-13(21)16-7-6-12(20)18-11(14(22)23)8-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,16,21)(H,18,20)(H,22,23)/t11-/m0/s1 |
| InChIKey | ZYPWTARGSONQIZ-NSHDSACASA-N |
| XLogP | 0.62 |
| TPSA | 144.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|