C18H26N4O4 — CID 59552634
methyl (2S)-2-[[(2R)-2-azido-3-methylbutanoyl]amino]-3-(4-propoxyphenyl)propanoate (PubChem CID 59552634) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R)-2-azido-3-methylbutanoyl]amino]-3-(4-propoxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[[(2R)-2-azido-3-methylbutanoyl]amino]-3-(4-propoxyphenyl)propanoate |
|---|---|
| PubChem CID | 59552634 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | methyl (2S)-2-[[(2R)-2-azido-3-methylbutanoyl]amino]-3-(4-propoxyphenyl)propanoate |
| SMILES | CCCOc1ccc(C[C@H](NC(=O)[C@H](N=[N+]=[N-])C(C)C)C(=O)OC)cc1 |
| InChI | InChI=1S/C18H26N4O4/c1-5-10-26-14-8-6-13(7-9-14)11-15(18(24)25-4)20-17(23)16(12(2)3)21-22-19/h6-9,12,15-16H,5,10-11H2,1-4H3,(H,20,23)/t15-,16+/m0/s1 |
| InChIKey | XPWBECXVLDMBTN-JKSUJKDBSA-N |
| XLogP | 3.01 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|