C20H28N4O7 — CID 76593667
methyl 3-[4-(1-acetyloxy-3-hydroxypropan-2-yl)oxyphenyl]-2-[(2-azido-3-methylbutanoyl)amino]propanoate (PubChem CID 76593667) has the molecular formula C20H28N4O7 and a molecular weight of 436.47 g/mol. Its IUPAC name is methyl 3-[4-(1-acetyloxy-3-hydroxypropan-2-yl)oxyphenyl]-2-[(2-azido-3-methylbutanoyl)amino]propanoate.
| Compound Name | methyl 3-[4-(1-acetyloxy-3-hydroxypropan-2-yl)oxyphenyl]-2-[(2-azido-3-methylbutanoyl)amino]propanoate |
|---|---|
| PubChem CID | 76593667 |
| Molecular Formula | C20H28N4O7 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | methyl 3-[4-(1-acetyloxy-3-hydroxypropan-2-yl)oxyphenyl]-2-[(2-azido-3-methylbutanoyl)amino]propanoate |
| SMILES | COC(=O)C(Cc1ccc(OC(CO)COC(C)=O)cc1)NC(=O)C(N=[N+]=[N-])C(C)C |
| InChI | InChI=1S/C20H28N4O7/c1-12(2)18(23-24-21)19(27)22-17(20(28)29-4)9-14-5-7-15(8-6-14)31-16(10-25)11-30-13(3)26/h5-8,12,16-18,25H,9-11H2,1-4H3,(H,22,27) |
| InChIKey | ZUYIBGXFFVNXGG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 159.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|