C19H30O5S — CID 154067831
(3S,5S)-5-methyl-3-[(4-methylphenyl)sulfonyloxymethyl]decanoic acid (PubChem CID 154067831) has the molecular formula C19H30O5S and a molecular weight of 370.51 g/mol. Its IUPAC name is (3S,5S)-5-methyl-3-[(4-methylphenyl)sulfonyloxymethyl]decanoic acid.
| Compound Name | (3S,5S)-5-methyl-3-[(4-methylphenyl)sulfonyloxymethyl]decanoic acid |
|---|---|
| PubChem CID | 154067831 |
| Molecular Formula | C19H30O5S |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (3S,5S)-5-methyl-3-[(4-methylphenyl)sulfonyloxymethyl]decanoic acid |
| SMILES | CCCCC[C@H](C)C[C@H](COS(=O)(=O)c1ccc(C)cc1)CC(=O)O |
| InChI | InChI=1S/C19H30O5S/c1-4-5-6-7-16(3)12-17(13-19(20)21)14-24-25(22,23)18-10-8-15(2)9-11-18/h8-11,16-17H,4-7,12-14H2,1-3H3,(H,20,21)/t16-,17-/m0/s1 |
| InChIKey | YGPOOMDKXSNNNZ-IRXDYDNUSA-N |
| XLogP | 4.40 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|