C24H27ClN2O6S — CID 90062877
2-[3-[(1-tert-butyl-5-chloro-6-oxopyridazin-4-yl)oxymethyl]phenoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 90062877) has the molecular formula C24H27ClN2O6S and a molecular weight of 507.01 g/mol. Its IUPAC name is 2-[3-[(1-tert-butyl-5-chloro-6-oxopyridazin-4-yl)oxymethyl]phenoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[3-[(1-tert-butyl-5-chloro-6-oxopyridazin-4-yl)oxymethyl]phenoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90062877 |
| Molecular Formula | C24H27ClN2O6S |
| Molecular Weight | 507.01 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 2-[3-[(1-tert-butyl-5-chloro-6-oxopyridazin-4-yl)oxymethyl]phenoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2cccc(COc3cnn(C(C)(C)C)c(=O)c3Cl)c2)cc1 |
| InChI | InChI=1S/C24H27ClN2O6S/c1-17-8-10-20(11-9-17)34(29,30)33-13-12-31-19-7-5-6-18(14-19)16-32-21-15-26-27(24(2,3)4)23(28)22(21)25/h5-11,14-15H,12-13,16H2,1-4H3 |
| InChIKey | HJSRSKLGDJGQGA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.01 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|