C19H24Cl2N2O3 — CID 118229064
5-[(4-butoxy-2-chlorophenyl)methoxy]-2-tert-butyl-4-chloropyridazin-3-one (PubChem CID 118229064) has the molecular formula C19H24Cl2N2O3 and a molecular weight of 399.32 g/mol. Its IUPAC name is 5-[(4-butoxy-2-chlorophenyl)methoxy]-2-tert-butyl-4-chloropyridazin-3-one.
| Compound Name | 5-[(4-butoxy-2-chlorophenyl)methoxy]-2-tert-butyl-4-chloropyridazin-3-one |
|---|---|
| PubChem CID | 118229064 |
| Molecular Formula | C19H24Cl2N2O3 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 5-[(4-butoxy-2-chlorophenyl)methoxy]-2-tert-butyl-4-chloropyridazin-3-one |
| SMILES | CCCCOc1ccc(COc2cnn(C(C)(C)C)c(=O)c2Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H24Cl2N2O3/c1-5-6-9-25-14-8-7-13(15(20)10-14)12-26-16-11-22-23(19(2,3)4)18(24)17(16)21/h7-8,10-11H,5-6,9,12H2,1-4H3 |
| InChIKey | KGTCNBHYWWKFTM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|