C19H25ClN2O5 — CID 90036732
2-tert-butyl-4-chloro-5-[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]methoxy]pyridazin-3-one (PubChem CID 90036732) has the molecular formula C19H25ClN2O5 and a molecular weight of 396.87 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-5-[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]methoxy]pyridazin-3-one.
| Compound Name | 2-tert-butyl-4-chloro-5-[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]methoxy]pyridazin-3-one |
|---|---|
| PubChem CID | 90036732 |
| Molecular Formula | C19H25ClN2O5 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-tert-butyl-4-chloro-5-[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]methoxy]pyridazin-3-one |
| SMILES | CC(C)(C)n1ncc(OCc2ccc(OCCOCCO)cc2)c(Cl)c1=O |
| InChI | InChI=1S/C19H25ClN2O5/c1-19(2,3)22-18(24)17(20)16(12-21-22)27-13-14-4-6-15(7-5-14)26-11-10-25-9-8-23/h4-7,12,23H,8-11,13H2,1-3H3 |
| InChIKey | BMANVMNDJVIJRE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|