C20H27ClN2O3S — CID 88522153
2-tert-butyl-4-chloro-5-[[4-(3-methyl-2-sulfanylbutoxy)phenyl]methoxy]pyridazin-3-one (PubChem CID 88522153) has the molecular formula C20H27ClN2O3S and a molecular weight of 410.97 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-5-[[4-(3-methyl-2-sulfanylbutoxy)phenyl]methoxy]pyridazin-3-one.
| Compound Name | 2-tert-butyl-4-chloro-5-[[4-(3-methyl-2-sulfanylbutoxy)phenyl]methoxy]pyridazin-3-one |
|---|---|
| PubChem CID | 88522153 |
| Molecular Formula | C20H27ClN2O3S |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-tert-butyl-4-chloro-5-[[4-(3-methyl-2-sulfanylbutoxy)phenyl]methoxy]pyridazin-3-one |
| SMILES | CC(C)C(S)COc1ccc(COc2cnn(C(C)(C)C)c(=O)c2Cl)cc1 |
| InChI | InChI=1S/C20H27ClN2O3S/c1-13(2)17(27)12-25-15-8-6-14(7-9-15)11-26-16-10-22-23(20(3,4)5)19(24)18(16)21/h6-10,13,17,27H,11-12H2,1-5H3 |
| InChIKey | VHWNTNZOXLINDM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|