C21H28ClFN2O4 — CID 90062690
2-tert-butyl-4-chloro-5-[[4-[2-(3-fluoropropoxy)ethoxymethyl]phenyl]methoxy]pyridazin-3-one (PubChem CID 90062690) has the molecular formula C21H28ClFN2O4 and a molecular weight of 426.92 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-5-[[4-[2-(3-fluoropropoxy)ethoxymethyl]phenyl]methoxy]pyridazin-3-one.
| Compound Name | 2-tert-butyl-4-chloro-5-[[4-[2-(3-fluoropropoxy)ethoxymethyl]phenyl]methoxy]pyridazin-3-one |
|---|---|
| PubChem CID | 90062690 |
| Molecular Formula | C21H28ClFN2O4 |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2-tert-butyl-4-chloro-5-[[4-[2-(3-fluoropropoxy)ethoxymethyl]phenyl]methoxy]pyridazin-3-one |
| SMILES | CC(C)(C)n1ncc(OCc2ccc(COCCOCCCF)cc2)c(Cl)c1=O |
| InChI | InChI=1S/C21H28ClFN2O4/c1-21(2,3)25-20(26)19(22)18(13-24-25)29-15-17-7-5-16(6-8-17)14-28-12-11-27-10-4-9-23/h5-8,13H,4,9-12,14-15H2,1-3H3 |
| InChIKey | WCDVGPSUCFFHED-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|