C20H25ClN2O6 — CID 90062832
2-[[4-[(1-tert-butyl-5-chloro-6-oxopyridazin-4-yl)oxymethyl]phenyl]methoxy]ethyl methyl carbonate (PubChem CID 90062832) has the molecular formula C20H25ClN2O6 and a molecular weight of 424.88 g/mol. Its IUPAC name is 2-[[4-[(1-tert-butyl-5-chloro-6-oxopyridazin-4-yl)oxymethyl]phenyl]methoxy]ethyl methyl carbonate.
| Compound Name | 2-[[4-[(1-tert-butyl-5-chloro-6-oxopyridazin-4-yl)oxymethyl]phenyl]methoxy]ethyl methyl carbonate |
|---|---|
| PubChem CID | 90062832 |
| Molecular Formula | C20H25ClN2O6 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2-[[4-[(1-tert-butyl-5-chloro-6-oxopyridazin-4-yl)oxymethyl]phenyl]methoxy]ethyl methyl carbonate |
| SMILES | COC(=O)OCCOCc1ccc(COc2cnn(C(C)(C)C)c(=O)c2Cl)cc1 |
| InChI | InChI=1S/C20H25ClN2O6/c1-20(2,3)23-18(24)17(21)16(11-22-23)29-13-15-7-5-14(6-8-15)12-27-9-10-28-19(25)26-4/h5-8,11H,9-10,12-13H2,1-4H3 |
| InChIKey | RSVDIZFYXLRKLO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|