C20H23ClN2O6 — CID 126513451
2-[[4-[(1-tert-butyl-5-chloro-6-oxopyridazin-4-yl)oxymethyl]phenyl]methoxy]ethyl 2-oxoacetate (PubChem CID 126513451) has the molecular formula C20H23ClN2O6 and a molecular weight of 422.87 g/mol. Its IUPAC name is 2-[[4-[(1-tert-butyl-5-chloro-6-oxopyridazin-4-yl)oxymethyl]phenyl]methoxy]ethyl 2-oxoacetate.
| Compound Name | 2-[[4-[(1-tert-butyl-5-chloro-6-oxopyridazin-4-yl)oxymethyl]phenyl]methoxy]ethyl 2-oxoacetate |
|---|---|
| PubChem CID | 126513451 |
| Molecular Formula | C20H23ClN2O6 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-[[4-[(1-tert-butyl-5-chloro-6-oxopyridazin-4-yl)oxymethyl]phenyl]methoxy]ethyl 2-oxoacetate |
| SMILES | CC(C)(C)n1ncc(OCc2ccc(COCCOC(=O)C=O)cc2)c(Cl)c1=O |
| InChI | InChI=1S/C20H23ClN2O6/c1-20(2,3)23-19(26)18(21)16(10-22-23)29-13-15-6-4-14(5-7-15)12-27-8-9-28-17(25)11-24/h4-7,10-11H,8-9,12-13H2,1-3H3 |
| InChIKey | DHSUHCOBASBBGP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|