C18H22ClFN2O4 — CID 90062686
4-chloro-5-[[4-(2-fluoroethoxymethyl)phenyl]methoxy]-2-(1-hydroxy-2-methylpropan-2-yl)pyridazin-3-one (PubChem CID 90062686) has the molecular formula C18H22ClFN2O4 and a molecular weight of 384.84 g/mol. Its IUPAC name is 4-chloro-5-[[4-(2-fluoroethoxymethyl)phenyl]methoxy]-2-(1-hydroxy-2-methylpropan-2-yl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[[4-(2-fluoroethoxymethyl)phenyl]methoxy]-2-(1-hydroxy-2-methylpropan-2-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 90062686 |
| Molecular Formula | C18H22ClFN2O4 |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 4-chloro-5-[[4-(2-fluoroethoxymethyl)phenyl]methoxy]-2-(1-hydroxy-2-methylpropan-2-yl)pyridazin-3-one |
| SMILES | CC(C)(CO)n1ncc(OCc2ccc(COCCF)cc2)c(Cl)c1=O |
| InChI | InChI=1S/C18H22ClFN2O4/c1-18(2,12-23)22-17(24)16(19)15(9-21-22)26-11-14-5-3-13(4-6-14)10-25-8-7-20/h3-6,9,23H,7-8,10-12H2,1-2H3 |
| InChIKey | PKRBLCLQUYHCAC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|