C17H21ClFN3O3 — CID 90038250
2-tert-butyl-4-chloro-5-[[6-(3-fluoropropoxy)-3-pyridinyl]methoxy]pyridazin-3-one (PubChem CID 90038250) has the molecular formula C17H21ClFN3O3 and a molecular weight of 369.82 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-5-[[6-(3-fluoropropoxy)-3-pyridinyl]methoxy]pyridazin-3-one.
| Compound Name | 2-tert-butyl-4-chloro-5-[[6-(3-fluoropropoxy)-3-pyridinyl]methoxy]pyridazin-3-one |
|---|---|
| PubChem CID | 90038250 |
| Molecular Formula | C17H21ClFN3O3 |
| Molecular Weight | 369.82 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 2-tert-butyl-4-chloro-5-[[6-(3-fluoropropoxy)-3-pyridinyl]methoxy]pyridazin-3-one |
| SMILES | CC(C)(C)n1ncc(OCc2ccc(OCCCF)nc2)c(Cl)c1=O |
| InChI | InChI=1S/C17H21ClFN3O3/c1-17(2,3)22-16(23)15(18)13(10-21-22)25-11-12-5-6-14(20-9-12)24-8-4-7-19/h5-6,9-10H,4,7-8,11H2,1-3H3 |
| InChIKey | LRFJJHCPWOXDAP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.82 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|